About propan-2-yl 6,8-dichlorooctanoate
propan-2-yl 6,8-dichlorooctanoate (PubChem CID 168876049) has the molecular formula C11H20Cl2O2
and a molecular weight of 255.18 g/mol. Its IUPAC name is propan-2-yl 6,8-dichlorooctanoate.
Molecular Properties
| Compound Name | propan-2-yl 6,8-dichlorooctanoate |
| PubChem CID | 168876049 |
| Molecular Formula | C11H20Cl2O2 |
| Molecular Weight | 255.18 g/mol |
| Exact Mass | 254.08 |
| IUPAC Name | propan-2-yl 6,8-dichlorooctanoate |
| SMILES | CC(C)OC(=O)CCCCC(Cl)CCCl |
| InChI | InChI=1S/C11H20Cl2O2/c1-9(2)15-11(14)6-4-3-5-10(13)7-8-12/h9-10H,3-8H2,1-2H3 |
| InChIKey | NMUMHBNLSYFIIV-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.18 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze propan-2-yl 6,8-dichlorooctanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yl 6,8-dichlorooctanoate?
The IUPAC name of propan-2-yl 6,8-dichlorooctanoate (CID 168876049) is propan-2-yl 6,8-dichlorooctanoate.
What is the SMILES notation for propan-2-yl 6,8-dichlorooctanoate?
The canonical SMILES for propan-2-yl 6,8-dichlorooctanoate is CC(C)OC(=O)CCCCC(Cl)CCCl.
What is the InChIKey of propan-2-yl 6,8-dichlorooctanoate?
The InChIKey is NMUMHBNLSYFIIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20Cl2O2/c1-9(2)15-11(14)6-4-3-5-10(13)7-8-12/h9-10H,3-8H2,1-2H3.
What are the key properties of propan-2-yl 6,8-dichlorooctanoate?
propan-2-yl 6,8-dichlorooctanoate has a molecular weight of 255.18 g/mol, XLogP of 3.73, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl 6,8-dichlorooctanoate is sourced from PubChem (CID 168876049), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).