About ethyl 6,8-dichlorooctanoate
ethyl 6,8-dichlorooctanoate (PubChem CID 14053) has the molecular formula C10H18Cl2O2
and a molecular weight of 241.16 g/mol. Its IUPAC name is ethyl 6,8-dichlorooctanoate.
Molecular Properties
| Compound Name | ethyl 6,8-dichlorooctanoate |
| PubChem CID | 14053 |
| Molecular Formula | C10H18Cl2O2 |
| Molecular Weight | 241.16 g/mol |
| Exact Mass | 240.07 |
| IUPAC Name | ethyl 6,8-dichlorooctanoate |
| SMILES | CCOC(=O)CCCCC(Cl)CCCl |
| InChI | InChI=1S/C10H18Cl2O2/c1-2-14-10(13)6-4-3-5-9(12)7-8-11/h9H,2-8H2,1H3 |
| InChIKey | RFYDWSNYTVVKBR-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.16 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze ethyl 6,8-dichlorooctanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 6,8-dichlorooctanoate?
The IUPAC name of ethyl 6,8-dichlorooctanoate (CID 14053) is ethyl 6,8-dichlorooctanoate.
What is the SMILES notation for ethyl 6,8-dichlorooctanoate?
The canonical SMILES for ethyl 6,8-dichlorooctanoate is CCOC(=O)CCCCC(Cl)CCCl.
What is the InChIKey of ethyl 6,8-dichlorooctanoate?
The InChIKey is RFYDWSNYTVVKBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18Cl2O2/c1-2-14-10(13)6-4-3-5-9(12)7-8-11/h9H,2-8H2,1H3.
What are the key properties of ethyl 6,8-dichlorooctanoate?
ethyl 6,8-dichlorooctanoate has a molecular weight of 241.16 g/mol, XLogP of 3.35, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 6,8-dichlorooctanoate is sourced from PubChem (CID 14053), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).