C8H19O4P — CID 11031085
(2R,3S)-3-diethoxyphosphorylbutan-2-ol (PubChem CID 11031085) has the molecular formula C8H19O4P and a molecular weight of 210.21 g/mol. Its IUPAC name is (2R,3S)-3-diethoxyphosphorylbutan-2-ol.
| Compound Name | (2R,3S)-3-diethoxyphosphorylbutan-2-ol |
|---|---|
| PubChem CID | 11031085 |
| Molecular Formula | C8H19O4P |
| Molecular Weight | 210.21 g/mol |
| Exact Mass | 210.10 |
| IUPAC Name | (2R,3S)-3-diethoxyphosphorylbutan-2-ol |
| SMILES | CCOP(=O)(OCC)[C@@H](C)[C@@H](C)O |
| InChI | InChI=1S/C8H19O4P/c1-5-11-13(10,12-6-2)8(4)7(3)9/h7-9H,5-6H2,1-4H3/t7-,8+/m1/s1 |
| InChIKey | JHOFEMGGZHDOAA-SFYZADRCSA-N |
| XLogP | 2.02 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.21 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|