C9H21O4P — CID 166436787
(2S,3R)-3-diethoxyphosphorylpentan-2-ol (PubChem CID 166436787) has the molecular formula C9H21O4P and a molecular weight of 224.24 g/mol. Its IUPAC name is (2S,3R)-3-diethoxyphosphorylpentan-2-ol.
| Compound Name | (2S,3R)-3-diethoxyphosphorylpentan-2-ol |
|---|---|
| PubChem CID | 166436787 |
| Molecular Formula | C9H21O4P |
| Molecular Weight | 224.24 g/mol |
| Exact Mass | 224.12 |
| IUPAC Name | (2S,3R)-3-diethoxyphosphorylpentan-2-ol |
| SMILES | CCOP(=O)(OCC)[C@H](CC)[C@H](C)O |
| InChI | InChI=1S/C9H21O4P/c1-5-9(8(4)10)14(11,12-6-2)13-7-3/h8-10H,5-7H2,1-4H3/t8-,9+/m0/s1 |
| InChIKey | OYUGZZBCVSOCBT-DTWKUNHWSA-N |
| XLogP | 2.41 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.24 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|