C40H89O15P5 — CID 163580993
2,8-bis(diethoxyphosphoryl)decane;2,7,8-tris(diethoxyphosphoryl)decane (PubChem CID 163580993) has the molecular formula C40H89O15P5 and a molecular weight of 965.01 g/mol. Its IUPAC name is 2,8-bis(diethoxyphosphoryl)decane;2,7,8-tris(diethoxyphosphoryl)decane.
| Compound Name | 2,8-bis(diethoxyphosphoryl)decane;2,7,8-tris(diethoxyphosphoryl)decane |
|---|---|
| PubChem CID | 163580993 |
| Molecular Formula | C40H89O15P5 |
| Molecular Weight | 965.01 g/mol |
| Exact Mass | 964.49 |
| IUPAC Name | 2,8-bis(diethoxyphosphoryl)decane;2,7,8-tris(diethoxyphosphoryl)decane |
| SMILES | CCOP(=O)(OCC)C(C)CCCCC(C(CC)P(=O)(OCC)OCC)P(=O)(OCC)OCC.CCOP(=O)(OCC)C(C)CCCCCC(CC)P(=O)(OCC)OCC |
| InChI | InChI=1S/C22H49O9P3.C18H40O6P2/c1-9-21(33(24,28-12-4)29-13-5)22(34(25,30-14-6)31-15-7)19-17-16-18-20(8)32(23,26-10-2)27-11-3;1-7-18(26(20,23-10-4)24-11-5)16-14-12-13-15-17(6)25(19,21-8-2)22-9-3/h20-22H,9-19H2,1-8H3;17-18H,7-16H2,1-6H3 |
| InChIKey | GHNGEEKSKFQJQV-UHFFFAOYSA-N |
| XLogP | 14.52 |
| TPSA | 177.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 39 |
| Heavy Atoms | 60 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 965.01 |
| LogP ≤ 5 | 14.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|