C16H30NO4P — CID 162739005
2-diethoxyphosphoryl-4-methyl-N-[(3S)-4-methylpent-1-yn-3-yl]pentanamide (PubChem CID 162739005) has the molecular formula C16H30NO4P and a molecular weight of 331.39 g/mol. Its IUPAC name is 2-diethoxyphosphoryl-4-methyl-N-[(3S)-4-methylpent-1-yn-3-yl]pentanamide.
| Compound Name | 2-diethoxyphosphoryl-4-methyl-N-[(3S)-4-methylpent-1-yn-3-yl]pentanamide |
|---|---|
| PubChem CID | 162739005 |
| Molecular Formula | C16H30NO4P |
| Molecular Weight | 331.39 g/mol |
| Exact Mass | 331.19 |
| IUPAC Name | 2-diethoxyphosphoryl-4-methyl-N-[(3S)-4-methylpent-1-yn-3-yl]pentanamide |
| SMILES | C#C[C@@H](NC(=O)C(CC(C)C)P(=O)(OCC)OCC)C(C)C |
| InChI | InChI=1S/C16H30NO4P/c1-8-14(13(6)7)17-16(18)15(11-12(4)5)22(19,20-9-2)21-10-3/h1,12-15H,9-11H2,2-7H3,(H,17,18)/t14-,15?/m1/s1 |
| InChIKey | YDFRHIMZHYETDB-GICMACPYSA-N |
| XLogP | 3.44 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.39 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|