C13H29O3P — CID 87328302
3-diethoxyphosphoryl-2,2,5-trimethylhexane (PubChem CID 87328302) has the molecular formula C13H29O3P and a molecular weight of 264.35 g/mol. Its IUPAC name is 3-diethoxyphosphoryl-2,2,5-trimethylhexane.
| Compound Name | 3-diethoxyphosphoryl-2,2,5-trimethylhexane |
|---|---|
| PubChem CID | 87328302 |
| Molecular Formula | C13H29O3P |
| Molecular Weight | 264.35 g/mol |
| Exact Mass | 264.19 |
| IUPAC Name | 3-diethoxyphosphoryl-2,2,5-trimethylhexane |
| SMILES | CCOP(=O)(OCC)C(CC(C)C)C(C)(C)C |
| InChI | InChI=1S/C13H29O3P/c1-8-15-17(14,16-9-2)12(10-11(3)4)13(5,6)7/h11-12H,8-10H2,1-7H3 |
| InChIKey | NRPMFFDSGHFMDO-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.35 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|