About 3-diethylphosphoryl-2,2,5-trimethylhexane
3-diethylphosphoryl-2,2,5-trimethylhexane (PubChem CID 118286657) has the molecular formula C13H29OP
and a molecular weight of 232.35 g/mol. Its IUPAC name is 3-diethylphosphoryl-2,2,5-trimethylhexane.
Molecular Properties
| Compound Name | 3-diethylphosphoryl-2,2,5-trimethylhexane |
| PubChem CID | 118286657 |
| Molecular Formula | C13H29OP |
| Molecular Weight | 232.35 g/mol |
| Exact Mass | 232.20 |
| IUPAC Name | 3-diethylphosphoryl-2,2,5-trimethylhexane |
| SMILES | CCP(=O)(CC)C(CC(C)C)C(C)(C)C |
| InChI | InChI=1S/C13H29OP/c1-8-15(14,9-2)12(10-11(3)4)13(5,6)7/h11-12H,8-10H2,1-7H3 |
| InChIKey | UEHRBZHTPRMKMX-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.35 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 3-diethylphosphoryl-2,2,5-trimethylhexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-diethylphosphoryl-2,2,5-trimethylhexane?
The IUPAC name of 3-diethylphosphoryl-2,2,5-trimethylhexane (CID 118286657) is 3-diethylphosphoryl-2,2,5-trimethylhexane.
What is the SMILES notation for 3-diethylphosphoryl-2,2,5-trimethylhexane?
The canonical SMILES for 3-diethylphosphoryl-2,2,5-trimethylhexane is CCP(=O)(CC)C(CC(C)C)C(C)(C)C.
What is the InChIKey of 3-diethylphosphoryl-2,2,5-trimethylhexane?
The InChIKey is UEHRBZHTPRMKMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H29OP/c1-8-15(14,9-2)12(10-11(3)4)13(5,6)7/h11-12H,8-10H2,1-7H3.
What are the key properties of 3-diethylphosphoryl-2,2,5-trimethylhexane?
3-diethylphosphoryl-2,2,5-trimethylhexane has a molecular weight of 232.35 g/mol, XLogP of 4.85, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-diethylphosphoryl-2,2,5-trimethylhexane is sourced from PubChem (CID 118286657), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).