C14H32NO2PS — CID 135006567
(S)-N-[(2R)-2-diethylphosphoryl-4-methylpentan-2-yl]-2-methylpropane-2-sulfinamide (PubChem CID 135006567) has the molecular formula C14H32NO2PS and a molecular weight of 309.46 g/mol. Its IUPAC name is (S)-N-[(2R)-2-diethylphosphoryl-4-methylpentan-2-yl]-2-methylpropane-2-sulfinamide.
| Compound Name | (S)-N-[(2R)-2-diethylphosphoryl-4-methylpentan-2-yl]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 135006567 |
| Molecular Formula | C14H32NO2PS |
| Molecular Weight | 309.46 g/mol |
| Exact Mass | 309.19 |
| IUPAC Name | (S)-N-[(2R)-2-diethylphosphoryl-4-methylpentan-2-yl]-2-methylpropane-2-sulfinamide |
| SMILES | CCP(=O)(CC)[C@](C)(CC(C)C)N[S@@](=O)C(C)(C)C |
| InChI | InChI=1S/C14H32NO2PS/c1-9-18(16,10-2)14(8,11-12(3)4)15-19(17)13(5,6)7/h12,15H,9-11H2,1-8H3/t14-,19+/m1/s1 |
| InChIKey | RPHCUDRPIDOYKA-KUHUBIRLSA-N |
| XLogP | 4.20 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.46 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|