C11H23NO3S — CID 157064590
carbon dioxide;2-methyl-N-(3-methylpentan-3-yl)propane-2-sulfinamide (PubChem CID 157064590) has the molecular formula C11H23NO3S and a molecular weight of 249.38 g/mol. Its IUPAC name is carbon dioxide;2-methyl-N-(3-methylpentan-3-yl)propane-2-sulfinamide.
| Compound Name | carbon dioxide;2-methyl-N-(3-methylpentan-3-yl)propane-2-sulfinamide |
|---|---|
| PubChem CID | 157064590 |
| Molecular Formula | C11H23NO3S |
| Molecular Weight | 249.38 g/mol |
| Exact Mass | 249.14 |
| IUPAC Name | carbon dioxide;2-methyl-N-(3-methylpentan-3-yl)propane-2-sulfinamide |
| SMILES | CCC(C)(CC)NS(=O)C(C)(C)C.O=C=O |
| InChI | InChI=1S/C10H23NOS.CO2/c1-7-10(6,8-2)11-13(12)9(3,4)5;2-1-3/h11H,7-8H2,1-6H3; |
| InChIKey | ABSNGLXFKHPCQY-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.38 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |