C15H35NO2SSi — CID 90089955
(S)-N-[(2R)-1-[tert-butyl(dimethyl)silyl]oxy-2-methylbutan-2-yl]-2-methylpropane-2-sulfinamide (PubChem CID 90089955) has the molecular formula C15H35NO2SSi and a molecular weight of 321.60 g/mol. Its IUPAC name is (S)-N-[(2R)-1-[tert-butyl(dimethyl)silyl]oxy-2-methylbutan-2-yl]-2-methylpropane-2-sulfinamide.
| Compound Name | (S)-N-[(2R)-1-[tert-butyl(dimethyl)silyl]oxy-2-methylbutan-2-yl]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 90089955 |
| Molecular Formula | C15H35NO2SSi |
| Molecular Weight | 321.60 g/mol |
| Exact Mass | 321.22 |
| IUPAC Name | (S)-N-[(2R)-1-[tert-butyl(dimethyl)silyl]oxy-2-methylbutan-2-yl]-2-methylpropane-2-sulfinamide |
| SMILES | CC[C@](C)(CO[Si](C)(C)C(C)(C)C)N[S@@](=O)C(C)(C)C |
| InChI | InChI=1S/C15H35NO2SSi/c1-11-15(8,16-19(17)13(2,3)4)12-18-20(9,10)14(5,6)7/h16H,11-12H2,1-10H3/t15-,19+/m1/s1 |
| InChIKey | RDPOIGGNCCITQV-BEFAXECRSA-N |
| XLogP | 4.23 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.60 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|