C9H20F2OSi — CID 123170783
tert-butyl-(2,2-difluoropropoxy)-dimethylsilane (PubChem CID 123170783) has the molecular formula C9H20F2OSi and a molecular weight of 210.34 g/mol. Its IUPAC name is tert-butyl-(2,2-difluoropropoxy)-dimethylsilane.
| Compound Name | tert-butyl-(2,2-difluoropropoxy)-dimethylsilane |
|---|---|
| PubChem CID | 123170783 |
| Molecular Formula | C9H20F2OSi |
| Molecular Weight | 210.34 g/mol |
| Exact Mass | 210.13 |
| IUPAC Name | tert-butyl-(2,2-difluoropropoxy)-dimethylsilane |
| SMILES | CC(F)(F)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C9H20F2OSi/c1-8(2,3)13(5,6)12-7-9(4,10)11/h7H2,1-6H3 |
| InChIKey | SEXALZNFVMVPAL-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.34 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|