C13H21F2NO2Si — CID 59634007
tert-butyl-[2,2-difluoro-2-(1-oxidopyridin-1-ium-4-yl)ethoxy]-dimethylsilane (PubChem CID 59634007) has the molecular formula C13H21F2NO2Si and a molecular weight of 289.40 g/mol. Its IUPAC name is tert-butyl-[2,2-difluoro-2-(1-oxidopyridin-1-ium-4-yl)ethoxy]-dimethylsilane.
| Compound Name | tert-butyl-[2,2-difluoro-2-(1-oxidopyridin-1-ium-4-yl)ethoxy]-dimethylsilane |
|---|---|
| PubChem CID | 59634007 |
| Molecular Formula | C13H21F2NO2Si |
| Molecular Weight | 289.40 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | tert-butyl-[2,2-difluoro-2-(1-oxidopyridin-1-ium-4-yl)ethoxy]-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OCC(F)(F)c1cc[n+]([O-])cc1 |
| InChI | InChI=1S/C13H21F2NO2Si/c1-12(2,3)19(4,5)18-10-13(14,15)11-6-8-16(17)9-7-11/h6-9H,10H2,1-5H3 |
| InChIKey | QIXBHOGHTJTEQH-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 36.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.40 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|