C15H26FNOSi — CID 66600694
tert-butyl-[2-(6-fluoro-3-pyridinyl)-2-methylpropoxy]-dimethylsilane (PubChem CID 66600694) has the molecular formula C15H26FNOSi and a molecular weight of 283.46 g/mol. Its IUPAC name is tert-butyl-[2-(6-fluoro-3-pyridinyl)-2-methylpropoxy]-dimethylsilane.
| Compound Name | tert-butyl-[2-(6-fluoro-3-pyridinyl)-2-methylpropoxy]-dimethylsilane |
|---|---|
| PubChem CID | 66600694 |
| Molecular Formula | C15H26FNOSi |
| Molecular Weight | 283.46 g/mol |
| Exact Mass | 283.18 |
| IUPAC Name | tert-butyl-[2-(6-fluoro-3-pyridinyl)-2-methylpropoxy]-dimethylsilane |
| SMILES | CC(C)(CO[Si](C)(C)C(C)(C)C)c1ccc(F)nc1 |
| InChI | InChI=1S/C15H26FNOSi/c1-14(2,3)19(6,7)18-11-15(4,5)12-8-9-13(16)17-10-12/h8-10H,11H2,1-7H3 |
| InChIKey | HQAXLRRVROPERV-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.46 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|