C15H26BrNOSi — CID 70200388
2-(4-bromophenyl)-1-[tert-butyl(dimethyl)silyl]oxypropan-2-amine (PubChem CID 70200388) has the molecular formula C15H26BrNOSi and a molecular weight of 344.37 g/mol. Its IUPAC name is 2-(4-bromophenyl)-1-[tert-butyl(dimethyl)silyl]oxypropan-2-amine.
| Compound Name | 2-(4-bromophenyl)-1-[tert-butyl(dimethyl)silyl]oxypropan-2-amine |
|---|---|
| PubChem CID | 70200388 |
| Molecular Formula | C15H26BrNOSi |
| Molecular Weight | 344.37 g/mol |
| Exact Mass | 343.10 |
| IUPAC Name | 2-(4-bromophenyl)-1-[tert-butyl(dimethyl)silyl]oxypropan-2-amine |
| SMILES | CC(N)(CO[Si](C)(C)C(C)(C)C)c1ccc(Br)cc1 |
| InChI | InChI=1S/C15H26BrNOSi/c1-14(2,3)19(5,6)18-11-15(4,17)12-7-9-13(16)10-8-12/h7-10H,11,17H2,1-6H3 |
| InChIKey | MHLHHDPOSGGAHG-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.37 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|