C27H49BrO3Si2 — CID 171078028
2-trimethylsilylethyl 2-(4-bromophenyl)-7-[tert-butyl(dimethyl)silyl]oxy-2,6,6-trimethylheptanoate (PubChem CID 171078028) has the molecular formula C27H49BrO3Si2 and a molecular weight of 557.76 g/mol. Its IUPAC name is 2-trimethylsilylethyl 2-(4-bromophenyl)-7-[tert-butyl(dimethyl)silyl]oxy-2,6,6-trimethylheptanoate.
| Compound Name | 2-trimethylsilylethyl 2-(4-bromophenyl)-7-[tert-butyl(dimethyl)silyl]oxy-2,6,6-trimethylheptanoate |
|---|---|
| PubChem CID | 171078028 |
| Molecular Formula | C27H49BrO3Si2 |
| Molecular Weight | 557.76 g/mol |
| Exact Mass | 556.24 |
| IUPAC Name | 2-trimethylsilylethyl 2-(4-bromophenyl)-7-[tert-butyl(dimethyl)silyl]oxy-2,6,6-trimethylheptanoate |
| SMILES | CC(C)(CCCC(C)(C(=O)OCC[Si](C)(C)C)c1ccc(Br)cc1)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C27H49BrO3Si2/c1-25(2,3)33(10,11)31-21-26(4,5)17-12-18-27(6,22-13-15-23(28)16-14-22)24(29)30-19-20-32(7,8)9/h13-16H,12,17-21H2,1-11H3 |
| InChIKey | JUHONASCOQXHRM-UHFFFAOYSA-N |
| XLogP | 8.81 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.76 |
| LogP ≤ 5 | 8.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|