C20H44O4Si — CID 10667273
4-[2-[4-[tert-butyl(dimethyl)silyl]oxy-3,3-dimethylbutoxy]ethoxy]-2,2-dimethylbutan-1-ol (PubChem CID 10667273) has the molecular formula C20H44O4Si and a molecular weight of 376.65 g/mol. Its IUPAC name is 4-[2-[4-[tert-butyl(dimethyl)silyl]oxy-3,3-dimethylbutoxy]ethoxy]-2,2-dimethylbutan-1-ol.
| Compound Name | 4-[2-[4-[tert-butyl(dimethyl)silyl]oxy-3,3-dimethylbutoxy]ethoxy]-2,2-dimethylbutan-1-ol |
|---|---|
| PubChem CID | 10667273 |
| Molecular Formula | C20H44O4Si |
| Molecular Weight | 376.65 g/mol |
| Exact Mass | 376.30 |
| IUPAC Name | 4-[2-[4-[tert-butyl(dimethyl)silyl]oxy-3,3-dimethylbutoxy]ethoxy]-2,2-dimethylbutan-1-ol |
| SMILES | CC(C)(CO)CCOCCOCCC(C)(C)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H44O4Si/c1-18(2,3)25(8,9)24-17-20(6,7)11-13-23-15-14-22-12-10-19(4,5)16-21/h21H,10-17H2,1-9H3 |
| InChIKey | MOAULAOGNBOCNE-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.65 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|