C15H33NO2Si — CID 141301688
5-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]-3,3-dimethylpentan-1-imine (PubChem CID 141301688) has the molecular formula C15H33NO2Si and a molecular weight of 287.52 g/mol. Its IUPAC name is 5-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]-3,3-dimethylpentan-1-imine.
| Compound Name | 5-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]-3,3-dimethylpentan-1-imine |
|---|---|
| PubChem CID | 141301688 |
| Molecular Formula | C15H33NO2Si |
| Molecular Weight | 287.52 g/mol |
| Exact Mass | 287.23 |
| IUPAC Name | 5-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]-3,3-dimethylpentan-1-imine |
| SMILES | [H]/N=C/CC(C)(C)CCOCCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C15H33NO2Si/c1-14(2,3)19(6,7)18-13-12-17-11-9-15(4,5)8-10-16/h10,16H,8-9,11-13H2,1-7H3/b16-10+ |
| InChIKey | TZRZTSPQBQGJKH-MHWRWJLKSA-N |
| XLogP | 4.48 |
| TPSA | 42.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.52 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|