C14H30O6Si — CID 170898180
2-[2-[2-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]ethoxy]ethoxy]acetic acid (PubChem CID 170898180) has the molecular formula C14H30O6Si and a molecular weight of 322.47 g/mol. Its IUPAC name is 2-[2-[2-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]ethoxy]ethoxy]acetic acid.
| Compound Name | 2-[2-[2-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]ethoxy]ethoxy]acetic acid |
|---|---|
| PubChem CID | 170898180 |
| Molecular Formula | C14H30O6Si |
| Molecular Weight | 322.47 g/mol |
| Exact Mass | 322.18 |
| IUPAC Name | 2-[2-[2-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]ethoxy]ethoxy]acetic acid |
| SMILES | CC(C)(C)[Si](C)(C)OCCOCCOCCOCC(=O)O |
| InChI | InChI=1S/C14H30O6Si/c1-14(2,3)21(4,5)20-11-10-18-7-6-17-8-9-19-12-13(15)16/h6-12H2,1-5H3,(H,15,16) |
| InChIKey | BGSPDMUJJYZJNY-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.47 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|