C12H27BrO3Si — CID 18469819
2-[2-(2-bromoethoxy)ethoxy]ethoxy-tert-butyl-dimethylsilane (PubChem CID 18469819) has the molecular formula C12H27BrO3Si and a molecular weight of 327.34 g/mol. Its IUPAC name is 2-[2-(2-bromoethoxy)ethoxy]ethoxy-tert-butyl-dimethylsilane.
| Compound Name | 2-[2-(2-bromoethoxy)ethoxy]ethoxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 18469819 |
| Molecular Formula | C12H27BrO3Si |
| Molecular Weight | 327.34 g/mol |
| Exact Mass | 326.09 |
| IUPAC Name | 2-[2-(2-bromoethoxy)ethoxy]ethoxy-tert-butyl-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OCCOCCOCCBr |
| InChI | InChI=1S/C12H27BrO3Si/c1-12(2,3)17(4,5)16-11-10-15-9-8-14-7-6-13/h6-11H2,1-5H3 |
| InChIKey | FVKQGXGGSCBBKQ-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.34 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|