C15H32O3Si — CID 86640420
5-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]-3,3-dimethylpentanal (PubChem CID 86640420) has the molecular formula C15H32O3Si and a molecular weight of 288.50 g/mol. Its IUPAC name is 5-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]-3,3-dimethylpentanal.
| Compound Name | 5-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]-3,3-dimethylpentanal |
|---|---|
| PubChem CID | 86640420 |
| Molecular Formula | C15H32O3Si |
| Molecular Weight | 288.50 g/mol |
| Exact Mass | 288.21 |
| IUPAC Name | 5-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]-3,3-dimethylpentanal |
| SMILES | CC(C)(CC=O)CCOCCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C15H32O3Si/c1-14(2,3)19(6,7)18-13-12-17-11-9-15(4,5)8-10-16/h10H,8-9,11-13H2,1-7H3 |
| InChIKey | XYXCDXCSGYTYLN-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.50 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|