C15H32O2Si — CID 99768812
7-[tert-butyl(dimethyl)silyl]oxy-5,5-dimethylheptan-2-one (PubChem CID 99768812) has the molecular formula C15H32O2Si and a molecular weight of 272.50 g/mol. Its IUPAC name is 7-[tert-butyl(dimethyl)silyl]oxy-5,5-dimethylheptan-2-one.
| Compound Name | 7-[tert-butyl(dimethyl)silyl]oxy-5,5-dimethylheptan-2-one |
|---|---|
| PubChem CID | 99768812 |
| Molecular Formula | C15H32O2Si |
| Molecular Weight | 272.50 g/mol |
| Exact Mass | 272.22 |
| IUPAC Name | 7-[tert-butyl(dimethyl)silyl]oxy-5,5-dimethylheptan-2-one |
| SMILES | CC(=O)CCC(C)(C)CCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C15H32O2Si/c1-13(16)9-10-15(5,6)11-12-17-18(7,8)14(2,3)4/h9-12H2,1-8H3 |
| InChIKey | YQBHEZUCDJPMOP-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.50 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|