C13H30O4Si — CID 91694118
tert-butyl-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]-dimethylsilane (PubChem CID 91694118) has the molecular formula C13H30O4Si and a molecular weight of 278.46 g/mol. Its IUPAC name is tert-butyl-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]-dimethylsilane.
| Compound Name | tert-butyl-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]-dimethylsilane |
|---|---|
| PubChem CID | 91694118 |
| Molecular Formula | C13H30O4Si |
| Molecular Weight | 278.46 g/mol |
| Exact Mass | 278.19 |
| IUPAC Name | tert-butyl-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]-dimethylsilane |
| SMILES | COCCOCCOCCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C13H30O4Si/c1-13(2,3)18(5,6)17-12-11-16-10-9-15-8-7-14-4/h7-12H2,1-6H3 |
| InChIKey | VKMQSVSVSHNHSU-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.46 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|