C13H28O5Si — CID 91694127
[tert-butyl(dimethyl)silyl] 2-[2-(2-methoxyethoxy)ethoxy]acetate (PubChem CID 91694127) has the molecular formula C13H28O5Si and a molecular weight of 292.45 g/mol. Its IUPAC name is [tert-butyl(dimethyl)silyl] 2-[2-(2-methoxyethoxy)ethoxy]acetate.
| Compound Name | [tert-butyl(dimethyl)silyl] 2-[2-(2-methoxyethoxy)ethoxy]acetate |
|---|---|
| PubChem CID | 91694127 |
| Molecular Formula | C13H28O5Si |
| Molecular Weight | 292.45 g/mol |
| Exact Mass | 292.17 |
| IUPAC Name | [tert-butyl(dimethyl)silyl] 2-[2-(2-methoxyethoxy)ethoxy]acetate |
| SMILES | COCCOCCOCC(=O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C13H28O5Si/c1-13(2,3)19(5,6)18-12(14)11-17-10-9-16-8-7-15-4/h7-11H2,1-6H3 |
| InChIKey | XOLFOKWZRJSCQI-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.45 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|