C16H34O8Si — CID 91694090
trimethylsilyl 2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]acetate (PubChem CID 91694090) has the molecular formula C16H34O8Si and a molecular weight of 382.53 g/mol. Its IUPAC name is trimethylsilyl 2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]acetate.
| Compound Name | trimethylsilyl 2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]acetate |
|---|---|
| PubChem CID | 91694090 |
| Molecular Formula | C16H34O8Si |
| Molecular Weight | 382.53 g/mol |
| Exact Mass | 382.20 |
| IUPAC Name | trimethylsilyl 2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]acetate |
| SMILES | COCCOCCOCCOCCOCCOCC(=O)O[Si](C)(C)C |
| InChI | InChI=1S/C16H34O8Si/c1-18-5-6-19-7-8-20-9-10-21-11-12-22-13-14-23-15-16(17)24-25(2,3)4/h5-15H2,1-4H3 |
| InChIKey | MMUJCUXYNCHYHF-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 81.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.53 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|