C13H26O5 — CID 113427120
1-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]-3,3-dimethylbutan-2-one (PubChem CID 113427120) has the molecular formula C13H26O5 and a molecular weight of 262.35 g/mol. Its IUPAC name is 1-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]-3,3-dimethylbutan-2-one.
| Compound Name | 1-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]-3,3-dimethylbutan-2-one |
|---|---|
| PubChem CID | 113427120 |
| Molecular Formula | C13H26O5 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.18 |
| IUPAC Name | 1-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]-3,3-dimethylbutan-2-one |
| SMILES | COCCOCCOCCOCC(=O)C(C)(C)C |
| InChI | InChI=1S/C13H26O5/c1-13(2,3)12(14)11-18-10-9-17-8-7-16-6-5-15-4/h5-11H2,1-4H3 |
| InChIKey | AKVHUHHDVXGULD-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|