C14H28O3 — CID 169040434
3,3-dimethyl-1-[2-(4-methylpentoxy)ethoxy]butan-2-one (PubChem CID 169040434) has the molecular formula C14H28O3 and a molecular weight of 244.37 g/mol. Its IUPAC name is 3,3-dimethyl-1-[2-(4-methylpentoxy)ethoxy]butan-2-one.
| Compound Name | 3,3-dimethyl-1-[2-(4-methylpentoxy)ethoxy]butan-2-one |
|---|---|
| PubChem CID | 169040434 |
| Molecular Formula | C14H28O3 |
| Molecular Weight | 244.37 g/mol |
| Exact Mass | 244.20 |
| IUPAC Name | 3,3-dimethyl-1-[2-(4-methylpentoxy)ethoxy]butan-2-one |
| SMILES | CC(C)CCCOCCOCC(=O)C(C)(C)C |
| InChI | InChI=1S/C14H28O3/c1-12(2)7-6-8-16-9-10-17-11-13(15)14(3,4)5/h12H,6-11H2,1-5H3 |
| InChIKey | GHEZUUCFACVGMO-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.37 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|