C16H35BF3O5Si- — CID 170899743
2-[2-[2-[2-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]ethoxy]ethoxy]ethoxy]ethyl-trifluoroboranuide (PubChem CID 170899743) has the molecular formula C16H35BF3O5Si- and a molecular weight of 403.34 g/mol. Its IUPAC name is 2-[2-[2-[2-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]ethoxy]ethoxy]ethoxy]ethyl-trifluoroboranuide.
| Compound Name | 2-[2-[2-[2-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]ethoxy]ethoxy]ethoxy]ethyl-trifluoroboranuide |
|---|---|
| PubChem CID | 170899743 |
| Molecular Formula | C16H35BF3O5Si- |
| Molecular Weight | 403.34 g/mol |
| Exact Mass | 403.23 |
| IUPAC Name | 2-[2-[2-[2-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]ethoxy]ethoxy]ethoxy]ethyl-trifluoroboranuide |
| SMILES | CC(C)(C)[Si](C)(C)OCCOCCOCCOCCOCC[B-](F)(F)F |
| InChI | InChI=1S/C16H35BF3O5Si/c1-16(2,3)26(4,5)25-15-14-24-13-12-23-11-10-22-9-8-21-7-6-17(18,19)20/h6-15H2,1-5H3/q-1 |
| InChIKey | BCFVEYZOOYDTCU-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.34 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|