C19H44N2O3Si — CID 158707795
N'-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-N-[3-(2-methoxyethoxy)propyl]pentane-1,5-diamine (PubChem CID 158707795) has the molecular formula C19H44N2O3Si and a molecular weight of 376.66 g/mol. Its IUPAC name is N'-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-N-[3-(2-methoxyethoxy)propyl]pentane-1,5-diamine.
| Compound Name | N'-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-N-[3-(2-methoxyethoxy)propyl]pentane-1,5-diamine |
|---|---|
| PubChem CID | 158707795 |
| Molecular Formula | C19H44N2O3Si |
| Molecular Weight | 376.66 g/mol |
| Exact Mass | 376.31 |
| IUPAC Name | N'-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-N-[3-(2-methoxyethoxy)propyl]pentane-1,5-diamine |
| SMILES | COCCOCCCNCCCCCNCCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H44N2O3Si/c1-19(2,3)25(5,6)24-16-14-21-12-9-7-8-11-20-13-10-15-23-18-17-22-4/h20-21H,7-18H2,1-6H3 |
| InChIKey | MTPPESOEKKMDTA-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 51.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.66 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|