C16H39NO2Si2 — CID 11427595
2-[tert-butyl(dimethyl)silyl]oxy-N-[2-[tert-butyl(dimethyl)silyl]oxyethyl]ethanamine (PubChem CID 11427595) has the molecular formula C16H39NO2Si2 and a molecular weight of 333.67 g/mol. Its IUPAC name is 2-[tert-butyl(dimethyl)silyl]oxy-N-[2-[tert-butyl(dimethyl)silyl]oxyethyl]ethanamine.
| Compound Name | 2-[tert-butyl(dimethyl)silyl]oxy-N-[2-[tert-butyl(dimethyl)silyl]oxyethyl]ethanamine |
|---|---|
| PubChem CID | 11427595 |
| Molecular Formula | C16H39NO2Si2 |
| Molecular Weight | 333.67 g/mol |
| Exact Mass | 333.25 |
| IUPAC Name | 2-[tert-butyl(dimethyl)silyl]oxy-N-[2-[tert-butyl(dimethyl)silyl]oxyethyl]ethanamine |
| SMILES | CC(C)(C)[Si](C)(C)OCCNCCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C16H39NO2Si2/c1-15(2,3)20(7,8)18-13-11-17-12-14-19-21(9,10)16(4,5)6/h17H,11-14H2,1-10H3 |
| InChIKey | OQOWEVQDYYJEQB-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.67 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|