About 2-[2,2-bis(4-bromophenyl)-2-hydroxyacetyl]oxyethyl-dimethylazanium
2-[2,2-bis(4-bromophenyl)-2-hydroxyacetyl]oxyethyl-dimethylazanium (PubChem CID 7012352) has the molecular formula C18H20Br2NO3+
and a molecular weight of 458.17 g/mol. Its IUPAC name is 2-[2,2-bis(4-bromophenyl)-2-hydroxyacetyl]oxyethyl-dimethylazanium.
Molecular Properties
| Compound Name | 2-[2,2-bis(4-bromophenyl)-2-hydroxyacetyl]oxyethyl-dimethylazanium |
| PubChem CID | 7012352 |
| Molecular Formula | C18H20Br2NO3+ |
| Molecular Weight | 458.17 g/mol |
| Exact Mass | 455.98 |
| IUPAC Name | 2-[2,2-bis(4-bromophenyl)-2-hydroxyacetyl]oxyethyl-dimethylazanium |
| SMILES | C[NH+](C)CCOC(=O)C(O)(c1ccc(Br)cc1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C18H19Br2NO3/c1-21(2)11-12-24-17(22)18(23,13-3-7-15(19)8-4-13)14-5-9-16(20)10-6-14/h3-10,23H,11-12H2,1-2H3/p+1 |
| InChIKey | LKYIXRPXFSQBGB-UHFFFAOYSA-O |
| XLogP | 2.14 |
| TPSA | 50.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 458.17 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[2,2-bis(4-bromophenyl)-2-hydroxyacetyl]oxyethyl-dimethylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2,2-bis(4-bromophenyl)-2-hydroxyacetyl]oxyethyl-dimethylazanium?
The IUPAC name of 2-[2,2-bis(4-bromophenyl)-2-hydroxyacetyl]oxyethyl-dimethylazanium (CID 7012352) is 2-[2,2-bis(4-bromophenyl)-2-hydroxyacetyl]oxyethyl-dimethylazanium.
What is the SMILES notation for 2-[2,2-bis(4-bromophenyl)-2-hydroxyacetyl]oxyethyl-dimethylazanium?
The canonical SMILES for 2-[2,2-bis(4-bromophenyl)-2-hydroxyacetyl]oxyethyl-dimethylazanium is C[NH+](C)CCOC(=O)C(O)(c1ccc(Br)cc1)c1ccc(Br)cc1.
What is the InChIKey of 2-[2,2-bis(4-bromophenyl)-2-hydroxyacetyl]oxyethyl-dimethylazanium?
The InChIKey is LKYIXRPXFSQBGB-UHFFFAOYSA-O. The full InChI is InChI=1S/C18H19Br2NO3/c1-21(2)11-12-24-17(22)18(23,13-3-7-15(19)8-4-13)14-5-9-16(20)10-6-14/h3-10,23H,11-12H2,1-2H3/p+1.
What are the key properties of 2-[2,2-bis(4-bromophenyl)-2-hydroxyacetyl]oxyethyl-dimethylazanium?
2-[2,2-bis(4-bromophenyl)-2-hydroxyacetyl]oxyethyl-dimethylazanium has a molecular weight of 458.17 g/mol, XLogP of 2.14, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2,2-bis(4-bromophenyl)-2-hydroxyacetyl]oxyethyl-dimethylazanium is sourced from PubChem (CID 7012352), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).