C18H20Br2NO3+ — CID 7012352
2-[2,2-bis(4-bromophenyl)-2-hydroxyacetyl]oxyethyl-dimethylazanium (PubChem CID 7012352) has the molecular formula C18H20Br2NO3+ and a molecular weight of 458.17 g/mol. Its IUPAC name is 2-[2,2-bis(4-bromophenyl)-2-hydroxyacetyl]oxyethyl-dimethylazanium.
| Compound Name | 2-[2,2-bis(4-bromophenyl)-2-hydroxyacetyl]oxyethyl-dimethylazanium |
|---|---|
| PubChem CID | 7012352 |
| Molecular Formula | C18H20Br2NO3+ |
| Molecular Weight | 458.17 g/mol |
| Exact Mass | 455.98 |
| IUPAC Name | 2-[2,2-bis(4-bromophenyl)-2-hydroxyacetyl]oxyethyl-dimethylazanium |
| SMILES | C[NH+](C)CCOC(=O)C(O)(c1ccc(Br)cc1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C18H19Br2NO3/c1-21(2)11-12-24-17(22)18(23,13-3-7-15(19)8-4-13)14-5-9-16(20)10-6-14/h3-10,23H,11-12H2,1-2H3/p+1 |
| InChIKey | LKYIXRPXFSQBGB-UHFFFAOYSA-O |
| XLogP | 2.14 |
| TPSA | 50.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.17 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |