C16H16Br2O2 — CID 100920235
(2R,3R)-2,3-bis(4-bromophenyl)butane-2,3-diol (PubChem CID 100920235) has the molecular formula C16H16Br2O2 and a molecular weight of 400.11 g/mol. Its IUPAC name is (2R,3R)-2,3-bis(4-bromophenyl)butane-2,3-diol.
| Compound Name | (2R,3R)-2,3-bis(4-bromophenyl)butane-2,3-diol |
|---|---|
| PubChem CID | 100920235 |
| Molecular Formula | C16H16Br2O2 |
| Molecular Weight | 400.11 g/mol |
| Exact Mass | 397.95 |
| IUPAC Name | (2R,3R)-2,3-bis(4-bromophenyl)butane-2,3-diol |
| SMILES | C[C@@](O)(c1ccc(Br)cc1)[C@](C)(O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C16H16Br2O2/c1-15(19,11-3-7-13(17)8-4-11)16(2,20)12-5-9-14(18)10-6-12/h3-10,19-20H,1-2H3/t15-,16-/m1/s1 |
| InChIKey | ZVWWNDSIHRLQKE-HZPDHXFCSA-N |
| XLogP | 4.33 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.11 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |