C22H30NO3+ — CID 3096626
tert-butyl-[2-(2-hydroxy-2,2-diphenylacetyl)oxyethyl]-dimethylazanium (PubChem CID 3096626) has the molecular formula C22H30NO3+ and a molecular weight of 356.49 g/mol. Its IUPAC name is tert-butyl-[2-(2-hydroxy-2,2-diphenylacetyl)oxyethyl]-dimethylazanium.
| Compound Name | tert-butyl-[2-(2-hydroxy-2,2-diphenylacetyl)oxyethyl]-dimethylazanium |
|---|---|
| PubChem CID | 3096626 |
| Molecular Formula | C22H30NO3+ |
| Molecular Weight | 356.49 g/mol |
| Exact Mass | 356.22 |
| IUPAC Name | tert-butyl-[2-(2-hydroxy-2,2-diphenylacetyl)oxyethyl]-dimethylazanium |
| SMILES | CC(C)(C)[N+](C)(C)CCOC(=O)C(O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H30NO3/c1-21(2,3)23(4,5)16-17-26-20(24)22(25,18-12-8-6-9-13-18)19-14-10-7-11-15-19/h6-15,25H,16-17H2,1-5H3/q+1 |
| InChIKey | VHSYXGGBYPYXDB-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.49 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|