C22H30INO3 — CID 167311681
diethyl-[1-(2-hydroxy-2,2-diphenylacetyl)oxypropan-2-yl]-methylazanium iodide (PubChem CID 167311681) has the molecular formula C22H30INO3 and a molecular weight of 483.39 g/mol. Its IUPAC name is diethyl-[1-(2-hydroxy-2,2-diphenylacetyl)oxypropan-2-yl]-methylazanium iodide.
| Compound Name | diethyl-[1-(2-hydroxy-2,2-diphenylacetyl)oxypropan-2-yl]-methylazanium iodide |
|---|---|
| PubChem CID | 167311681 |
| Molecular Formula | C22H30INO3 |
| Molecular Weight | 483.39 g/mol |
| Exact Mass | 483.13 |
| IUPAC Name | diethyl-[1-(2-hydroxy-2,2-diphenylacetyl)oxypropan-2-yl]-methylazanium iodide |
| SMILES | CC[N+](C)(CC)C(C)COC(=O)C(O)(c1ccccc1)c1ccccc1.[I-] |
| InChI | InChI=1S/C22H30NO3.HI/c1-5-23(4,6-2)18(3)17-26-21(24)22(25,19-13-9-7-10-14-19)20-15-11-8-12-16-20;/h7-16,18,25H,5-6,17H2,1-4H3;1H/q+1;/p-1 |
| InChIKey | DGFXLXNLFFWWGD-UHFFFAOYSA-M |
| XLogP | 0.34 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.39 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|