C24H22O4 — CID 7191528
[2-(4-ethylphenyl)-2-oxoethyl] 2-hydroxy-2,2-diphenylacetate (PubChem CID 7191528) has the molecular formula C24H22O4 and a molecular weight of 374.44 g/mol. Its IUPAC name is [2-(4-ethylphenyl)-2-oxoethyl] 2-hydroxy-2,2-diphenylacetate.
| Compound Name | [2-(4-ethylphenyl)-2-oxoethyl] 2-hydroxy-2,2-diphenylacetate |
|---|---|
| PubChem CID | 7191528 |
| Molecular Formula | C24H22O4 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | [2-(4-ethylphenyl)-2-oxoethyl] 2-hydroxy-2,2-diphenylacetate |
| SMILES | CCc1ccc(C(=O)COC(=O)C(O)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C24H22O4/c1-2-18-13-15-19(16-14-18)22(25)17-28-23(26)24(27,20-9-5-3-6-10-20)21-11-7-4-8-12-21/h3-16,27H,2,17H2,1H3 |
| InChIKey | HJGLBJQGUDSZQR-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |