C22H17FO4 — CID 8675820
[2-(3-fluorophenyl)-2-oxoethyl] 2-hydroxy-2,2-diphenylacetate (PubChem CID 8675820) has the molecular formula C22H17FO4 and a molecular weight of 364.37 g/mol. Its IUPAC name is [2-(3-fluorophenyl)-2-oxoethyl] 2-hydroxy-2,2-diphenylacetate.
| Compound Name | [2-(3-fluorophenyl)-2-oxoethyl] 2-hydroxy-2,2-diphenylacetate |
|---|---|
| PubChem CID | 8675820 |
| Molecular Formula | C22H17FO4 |
| Molecular Weight | 364.37 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | [2-(3-fluorophenyl)-2-oxoethyl] 2-hydroxy-2,2-diphenylacetate |
| SMILES | O=C(COC(=O)C(O)(c1ccccc1)c1ccccc1)c1cccc(F)c1 |
| InChI | InChI=1S/C22H17FO4/c23-19-13-7-8-16(14-19)20(24)15-27-21(25)22(26,17-9-3-1-4-10-17)18-11-5-2-6-12-18/h1-14,26H,15H2 |
| InChIKey | BYQQORWWAOFNJP-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.37 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |