C29H24O5 — CID 4269875
[2-oxo-2-(4-phenylmethoxyphenyl)ethyl] 2-hydroxy-2,2-diphenylacetate (PubChem CID 4269875) has the molecular formula C29H24O5 and a molecular weight of 452.51 g/mol. Its IUPAC name is [2-oxo-2-(4-phenylmethoxyphenyl)ethyl] 2-hydroxy-2,2-diphenylacetate.
| Compound Name | [2-oxo-2-(4-phenylmethoxyphenyl)ethyl] 2-hydroxy-2,2-diphenylacetate |
|---|---|
| PubChem CID | 4269875 |
| Molecular Formula | C29H24O5 |
| Molecular Weight | 452.51 g/mol |
| Exact Mass | 452.16 |
| IUPAC Name | [2-oxo-2-(4-phenylmethoxyphenyl)ethyl] 2-hydroxy-2,2-diphenylacetate |
| SMILES | O=C(COC(=O)C(O)(c1ccccc1)c1ccccc1)c1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C29H24O5/c30-27(23-16-18-26(19-17-23)33-20-22-10-4-1-5-11-22)21-34-28(31)29(32,24-12-6-2-7-13-24)25-14-8-3-9-15-25/h1-19,32H,20-21H2 |
| InChIKey | NBZDBQGZYHDXTA-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.51 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |