C24H22O6 — CID 7191512
[2-(3,4-dimethoxyphenyl)-2-oxoethyl] 2-hydroxy-2,2-diphenylacetate (PubChem CID 7191512) has the molecular formula C24H22O6 and a molecular weight of 406.43 g/mol. Its IUPAC name is [2-(3,4-dimethoxyphenyl)-2-oxoethyl] 2-hydroxy-2,2-diphenylacetate.
| Compound Name | [2-(3,4-dimethoxyphenyl)-2-oxoethyl] 2-hydroxy-2,2-diphenylacetate |
|---|---|
| PubChem CID | 7191512 |
| Molecular Formula | C24H22O6 |
| Molecular Weight | 406.43 g/mol |
| Exact Mass | 406.14 |
| IUPAC Name | [2-(3,4-dimethoxyphenyl)-2-oxoethyl] 2-hydroxy-2,2-diphenylacetate |
| SMILES | COc1ccc(C(=O)COC(=O)C(O)(c2ccccc2)c2ccccc2)cc1OC |
| InChI | InChI=1S/C24H22O6/c1-28-21-14-13-17(15-22(21)29-2)20(25)16-30-23(26)24(27,18-9-5-3-6-10-18)19-11-7-4-8-12-19/h3-15,27H,16H2,1-2H3 |
| InChIKey | ULBWREXTYDJQEK-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.43 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |