C19H21NO7S — CID 7909287
[2-(3,4-dimethoxyphenyl)-2-oxoethyl] 3-(benzenesulfonamido)propanoate (PubChem CID 7909287) has the molecular formula C19H21NO7S and a molecular weight of 407.44 g/mol. Its IUPAC name is [2-(3,4-dimethoxyphenyl)-2-oxoethyl] 3-(benzenesulfonamido)propanoate.
| Compound Name | [2-(3,4-dimethoxyphenyl)-2-oxoethyl] 3-(benzenesulfonamido)propanoate |
|---|---|
| PubChem CID | 7909287 |
| Molecular Formula | C19H21NO7S |
| Molecular Weight | 407.44 g/mol |
| Exact Mass | 407.10 |
| IUPAC Name | [2-(3,4-dimethoxyphenyl)-2-oxoethyl] 3-(benzenesulfonamido)propanoate |
| SMILES | COc1ccc(C(=O)COC(=O)CCNS(=O)(=O)c2ccccc2)cc1OC |
| InChI | InChI=1S/C19H21NO7S/c1-25-17-9-8-14(12-18(17)26-2)16(21)13-27-19(22)10-11-20-28(23,24)15-6-4-3-5-7-15/h3-9,12,20H,10-11,13H2,1-2H3 |
| InChIKey | AMXYYNWKBIPXPG-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.44 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |