C18H19N3O9S — CID 4831684
[2-(3,4-dimethoxyphenyl)-2-oxoethyl] 2-[(4-amino-3-nitrophenyl)sulfonylamino]acetate (PubChem CID 4831684) has the molecular formula C18H19N3O9S and a molecular weight of 453.43 g/mol. Its IUPAC name is [2-(3,4-dimethoxyphenyl)-2-oxoethyl] 2-[(4-amino-3-nitrophenyl)sulfonylamino]acetate.
| Compound Name | [2-(3,4-dimethoxyphenyl)-2-oxoethyl] 2-[(4-amino-3-nitrophenyl)sulfonylamino]acetate |
|---|---|
| PubChem CID | 4831684 |
| Molecular Formula | C18H19N3O9S |
| Molecular Weight | 453.43 g/mol |
| Exact Mass | 453.08 |
| IUPAC Name | [2-(3,4-dimethoxyphenyl)-2-oxoethyl] 2-[(4-amino-3-nitrophenyl)sulfonylamino]acetate |
| SMILES | COc1ccc(C(=O)COC(=O)CNS(=O)(=O)c2ccc(N)c([N+](=O)[O-])c2)cc1OC |
| InChI | InChI=1S/C18H19N3O9S/c1-28-16-6-3-11(7-17(16)29-2)15(22)10-30-18(23)9-20-31(26,27)12-4-5-13(19)14(8-12)21(24)25/h3-8,20H,9-10,19H2,1-2H3 |
| InChIKey | JEMOZYDLIOYVLW-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 177.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.43 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|