C16H14ClFN4O7S — CID 4841721
[2-(3-chloro-4-fluoroanilino)-2-oxoethyl] 2-[(4-amino-3-nitrophenyl)sulfonylamino]acetate (PubChem CID 4841721) has the molecular formula C16H14ClFN4O7S and a molecular weight of 460.83 g/mol. Its IUPAC name is [2-(3-chloro-4-fluoroanilino)-2-oxoethyl] 2-[(4-amino-3-nitrophenyl)sulfonylamino]acetate.
| Compound Name | [2-(3-chloro-4-fluoroanilino)-2-oxoethyl] 2-[(4-amino-3-nitrophenyl)sulfonylamino]acetate |
|---|---|
| PubChem CID | 4841721 |
| Molecular Formula | C16H14ClFN4O7S |
| Molecular Weight | 460.83 g/mol |
| Exact Mass | 460.03 |
| IUPAC Name | [2-(3-chloro-4-fluoroanilino)-2-oxoethyl] 2-[(4-amino-3-nitrophenyl)sulfonylamino]acetate |
| SMILES | Nc1ccc(S(=O)(=O)NCC(=O)OCC(=O)Nc2ccc(F)c(Cl)c2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H14ClFN4O7S/c17-11-5-9(1-3-12(11)18)21-15(23)8-29-16(24)7-20-30(27,28)10-2-4-13(19)14(6-10)22(25)26/h1-6,20H,7-8,19H2,(H,21,23) |
| InChIKey | SISDADYIBKUVLF-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 170.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.83 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|