C16H12ClFN2O5 — CID 7833585
[2-(3-chloro-4-fluoroanilino)-2-oxoethyl] 3-methyl-4-nitrobenzoate (PubChem CID 7833585) has the molecular formula C16H12ClFN2O5 and a molecular weight of 366.73 g/mol. Its IUPAC name is [2-(3-chloro-4-fluoroanilino)-2-oxoethyl] 3-methyl-4-nitrobenzoate.
| Compound Name | [2-(3-chloro-4-fluoroanilino)-2-oxoethyl] 3-methyl-4-nitrobenzoate |
|---|---|
| PubChem CID | 7833585 |
| Molecular Formula | C16H12ClFN2O5 |
| Molecular Weight | 366.73 g/mol |
| Exact Mass | 366.04 |
| IUPAC Name | [2-(3-chloro-4-fluoroanilino)-2-oxoethyl] 3-methyl-4-nitrobenzoate |
| SMILES | Cc1cc(C(=O)OCC(=O)Nc2ccc(F)c(Cl)c2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H12ClFN2O5/c1-9-6-10(2-5-14(9)20(23)24)16(22)25-8-15(21)19-11-3-4-13(18)12(17)7-11/h2-7H,8H2,1H3,(H,19,21) |
| InChIKey | IPSSKYHVFSVOMT-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.73 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|