About [2-(dibenzofuran-2-ylamino)-2-oxoethyl] 3-methyl-4-nitrobenzoate
[2-(dibenzofuran-2-ylamino)-2-oxoethyl] 3-methyl-4-nitrobenzoate (PubChem CID 8509963) has the molecular formula C22H16N2O6
and a molecular weight of 404.38 g/mol. Its IUPAC name is [2-(dibenzofuran-2-ylamino)-2-oxoethyl] 3-methyl-4-nitrobenzoate.
Molecular Properties
| Compound Name | [2-(dibenzofuran-2-ylamino)-2-oxoethyl] 3-methyl-4-nitrobenzoate |
| PubChem CID | 8509963 |
| Molecular Formula | C22H16N2O6 |
| Molecular Weight | 404.38 g/mol |
| Exact Mass | 404.10 |
| IUPAC Name | [2-(dibenzofuran-2-ylamino)-2-oxoethyl] 3-methyl-4-nitrobenzoate |
| SMILES | Cc1cc(C(=O)OCC(=O)Nc2ccc3oc4ccccc4c3c2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C22H16N2O6/c1-13-10-14(6-8-18(13)24(27)28)22(26)29-12-21(25)23-15-7-9-20-17(11-15)16-4-2-3-5-19(16)30-20/h2-11H,12H2,1H3,(H,23,25) |
| InChIKey | RUTORYZZAVMOQA-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 111.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 404.38 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [2-(dibenzofuran-2-ylamino)-2-oxoethyl] 3-methyl-4-nitrobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(dibenzofuran-2-ylamino)-2-oxoethyl] 3-methyl-4-nitrobenzoate?
The IUPAC name of [2-(dibenzofuran-2-ylamino)-2-oxoethyl] 3-methyl-4-nitrobenzoate (CID 8509963) is [2-(dibenzofuran-2-ylamino)-2-oxoethyl] 3-methyl-4-nitrobenzoate.
What is the SMILES notation for [2-(dibenzofuran-2-ylamino)-2-oxoethyl] 3-methyl-4-nitrobenzoate?
The canonical SMILES for [2-(dibenzofuran-2-ylamino)-2-oxoethyl] 3-methyl-4-nitrobenzoate is Cc1cc(C(=O)OCC(=O)Nc2ccc3oc4ccccc4c3c2)ccc1[N+](=O)[O-].
What is the InChIKey of [2-(dibenzofuran-2-ylamino)-2-oxoethyl] 3-methyl-4-nitrobenzoate?
The InChIKey is RUTORYZZAVMOQA-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H16N2O6/c1-13-10-14(6-8-18(13)24(27)28)22(26)29-12-21(25)23-15-7-9-20-17(11-15)16-4-2-3-5-19(16)30-20/h2-11H,12H2,1H3,(H,23,25).
What are the key properties of [2-(dibenzofuran-2-ylamino)-2-oxoethyl] 3-methyl-4-nitrobenzoate?
[2-(dibenzofuran-2-ylamino)-2-oxoethyl] 3-methyl-4-nitrobenzoate has a molecular weight of 404.38 g/mol, XLogP of 4.60, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(dibenzofuran-2-ylamino)-2-oxoethyl] 3-methyl-4-nitrobenzoate is sourced from PubChem (CID 8509963), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).