C20H16F2N2O5S — CID 18775480
[2-(3,4-difluoroanilino)-2-oxoethyl] 2-(naphthalen-2-ylsulfonylamino)acetate (PubChem CID 18775480) has the molecular formula C20H16F2N2O5S and a molecular weight of 434.42 g/mol. Its IUPAC name is [2-(3,4-difluoroanilino)-2-oxoethyl] 2-(naphthalen-2-ylsulfonylamino)acetate.
| Compound Name | [2-(3,4-difluoroanilino)-2-oxoethyl] 2-(naphthalen-2-ylsulfonylamino)acetate |
|---|---|
| PubChem CID | 18775480 |
| Molecular Formula | C20H16F2N2O5S |
| Molecular Weight | 434.42 g/mol |
| Exact Mass | 434.07 |
| IUPAC Name | [2-(3,4-difluoroanilino)-2-oxoethyl] 2-(naphthalen-2-ylsulfonylamino)acetate |
| SMILES | O=C(COC(=O)CNS(=O)(=O)c1ccc2ccccc2c1)Nc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C20H16F2N2O5S/c21-17-8-6-15(10-18(17)22)24-19(25)12-29-20(26)11-23-30(27,28)16-7-5-13-3-1-2-4-14(13)9-16/h1-10,23H,11-12H2,(H,24,25) |
| InChIKey | OPTBWOJTNJWOPV-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.42 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |