C19H21N3O9S2 — CID 4841722
[2-(2,5-dimethoxyanilino)-2-oxoethyl] 2-[(4-methylsulfanyl-3-nitrophenyl)sulfonylamino]acetate (PubChem CID 4841722) has the molecular formula C19H21N3O9S2 and a molecular weight of 499.52 g/mol. Its IUPAC name is [2-(2,5-dimethoxyanilino)-2-oxoethyl] 2-[(4-methylsulfanyl-3-nitrophenyl)sulfonylamino]acetate.
| Compound Name | [2-(2,5-dimethoxyanilino)-2-oxoethyl] 2-[(4-methylsulfanyl-3-nitrophenyl)sulfonylamino]acetate |
|---|---|
| PubChem CID | 4841722 |
| Molecular Formula | C19H21N3O9S2 |
| Molecular Weight | 499.52 g/mol |
| Exact Mass | 499.07 |
| IUPAC Name | [2-(2,5-dimethoxyanilino)-2-oxoethyl] 2-[(4-methylsulfanyl-3-nitrophenyl)sulfonylamino]acetate |
| SMILES | COc1ccc(OC)c(NC(=O)COC(=O)CNS(=O)(=O)c2ccc(SC)c([N+](=O)[O-])c2)c1 |
| InChI | InChI=1S/C19H21N3O9S2/c1-29-12-4-6-16(30-2)14(8-12)21-18(23)11-31-19(24)10-20-33(27,28)13-5-7-17(32-3)15(9-13)22(25)26/h4-9,20H,10-11H2,1-3H3,(H,21,23) |
| InChIKey | KSDRDJIOMKHFNX-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 163.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.52 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|