C18H18FN3O7S2 — CID 41119890
[2-[(4-fluorophenyl)methylamino]-2-oxoethyl] 2-[(4-methylsulfanyl-3-nitrophenyl)sulfonylamino]acetate (PubChem CID 41119890) has the molecular formula C18H18FN3O7S2 and a molecular weight of 471.49 g/mol. Its IUPAC name is [2-[(4-fluorophenyl)methylamino]-2-oxoethyl] 2-[(4-methylsulfanyl-3-nitrophenyl)sulfonylamino]acetate.
| Compound Name | [2-[(4-fluorophenyl)methylamino]-2-oxoethyl] 2-[(4-methylsulfanyl-3-nitrophenyl)sulfonylamino]acetate |
|---|---|
| PubChem CID | 41119890 |
| Molecular Formula | C18H18FN3O7S2 |
| Molecular Weight | 471.49 g/mol |
| Exact Mass | 471.06 |
| IUPAC Name | [2-[(4-fluorophenyl)methylamino]-2-oxoethyl] 2-[(4-methylsulfanyl-3-nitrophenyl)sulfonylamino]acetate |
| SMILES | CSc1ccc(S(=O)(=O)NCC(=O)OCC(=O)NCc2ccc(F)cc2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H18FN3O7S2/c1-30-16-7-6-14(8-15(16)22(25)26)31(27,28)21-10-18(24)29-11-17(23)20-9-12-2-4-13(19)5-3-12/h2-8,21H,9-11H2,1H3,(H,20,23) |
| InChIKey | AKTLYSHSOZTNMI-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 144.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.49 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|