C20H18ClN3O6S2 — CID 41119820
(2-chloro-7-methylquinolin-3-yl)methyl 2-[(4-methylsulfanyl-3-nitrophenyl)sulfonylamino]acetate (PubChem CID 41119820) has the molecular formula C20H18ClN3O6S2 and a molecular weight of 495.97 g/mol. Its IUPAC name is (2-chloro-7-methylquinolin-3-yl)methyl 2-[(4-methylsulfanyl-3-nitrophenyl)sulfonylamino]acetate.
| Compound Name | (2-chloro-7-methylquinolin-3-yl)methyl 2-[(4-methylsulfanyl-3-nitrophenyl)sulfonylamino]acetate |
|---|---|
| PubChem CID | 41119820 |
| Molecular Formula | C20H18ClN3O6S2 |
| Molecular Weight | 495.97 g/mol |
| Exact Mass | 495.03 |
| IUPAC Name | (2-chloro-7-methylquinolin-3-yl)methyl 2-[(4-methylsulfanyl-3-nitrophenyl)sulfonylamino]acetate |
| SMILES | CSc1ccc(S(=O)(=O)NCC(=O)OCc2cc3ccc(C)cc3nc2Cl)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H18ClN3O6S2/c1-12-3-4-13-8-14(20(21)23-16(13)7-12)11-30-19(25)10-22-32(28,29)15-5-6-18(31-2)17(9-15)24(26)27/h3-9,22H,10-11H2,1-2H3 |
| InChIKey | NLOWBDQYSHHDEZ-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 128.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.97 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|