C12H15N2O6S2- — CID 7063526
2-[[4-(2-methylpropylsulfanyl)-3-nitrophenyl]sulfonylamino]acetate (PubChem CID 7063526) has the molecular formula C12H15N2O6S2- and a molecular weight of 347.39 g/mol. Its IUPAC name is 2-[[4-(2-methylpropylsulfanyl)-3-nitrophenyl]sulfonylamino]acetate.
| Compound Name | 2-[[4-(2-methylpropylsulfanyl)-3-nitrophenyl]sulfonylamino]acetate |
|---|---|
| PubChem CID | 7063526 |
| Molecular Formula | C12H15N2O6S2- |
| Molecular Weight | 347.39 g/mol |
| Exact Mass | 347.04 |
| IUPAC Name | 2-[[4-(2-methylpropylsulfanyl)-3-nitrophenyl]sulfonylamino]acetate |
| SMILES | CC(C)CSc1ccc(S(=O)(=O)NCC(=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H16N2O6S2/c1-8(2)7-21-11-4-3-9(5-10(11)14(17)18)22(19,20)13-6-12(15)16/h3-5,8,13H,6-7H2,1-2H3,(H,15,16)/p-1 |
| InChIKey | ZYSINNBAHKQHNZ-UHFFFAOYSA-M |
| XLogP | 0.37 |
| TPSA | 129.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.39 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|