C15H21N3O5S2 — CID 9442203
2-[[4-(2-methylpropylsulfanyl)-3-nitrophenyl]sulfonylamino]-N-prop-2-enylacetamide (PubChem CID 9442203) has the molecular formula C15H21N3O5S2 and a molecular weight of 387.48 g/mol. Its IUPAC name is 2-[[4-(2-methylpropylsulfanyl)-3-nitrophenyl]sulfonylamino]-N-prop-2-enylacetamide.
| Compound Name | 2-[[4-(2-methylpropylsulfanyl)-3-nitrophenyl]sulfonylamino]-N-prop-2-enylacetamide |
|---|---|
| PubChem CID | 9442203 |
| Molecular Formula | C15H21N3O5S2 |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.09 |
| IUPAC Name | 2-[[4-(2-methylpropylsulfanyl)-3-nitrophenyl]sulfonylamino]-N-prop-2-enylacetamide |
| SMILES | C=CCNC(=O)CNS(=O)(=O)c1ccc(SCC(C)C)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H21N3O5S2/c1-4-7-16-15(19)9-17-25(22,23)12-5-6-14(24-10-11(2)3)13(8-12)18(20)21/h4-6,8,11,17H,1,7,9-10H2,2-3H3,(H,16,19) |
| InChIKey | PYCROEUFJCWRNH-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 118.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|