C14H14N2O5S2 — CID 9212797
4-(2-hydroxyethylsulfanyl)-3-nitro-N-phenylbenzenesulfonamide (PubChem CID 9212797) has the molecular formula C14H14N2O5S2 and a molecular weight of 354.41 g/mol. Its IUPAC name is 4-(2-hydroxyethylsulfanyl)-3-nitro-N-phenylbenzenesulfonamide.
| Compound Name | 4-(2-hydroxyethylsulfanyl)-3-nitro-N-phenylbenzenesulfonamide |
|---|---|
| PubChem CID | 9212797 |
| Molecular Formula | C14H14N2O5S2 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.03 |
| IUPAC Name | 4-(2-hydroxyethylsulfanyl)-3-nitro-N-phenylbenzenesulfonamide |
| SMILES | O=[N+]([O-])c1cc(S(=O)(=O)Nc2ccccc2)ccc1SCCO |
| InChI | InChI=1S/C14H14N2O5S2/c17-8-9-22-14-7-6-12(10-13(14)16(18)19)23(20,21)15-11-4-2-1-3-5-11/h1-7,10,15,17H,8-9H2 |
| InChIKey | XFIJYCIOTPQIEA-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 109.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|